C12H19IN4O2 — CID 111064851
1,1,3,3-tetramethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111064851) has the molecular formula C12H19IN4O2 and a molecular weight of 378.21 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,1,3,3-tetramethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111064851 |
| Molecular Formula | C12H19IN4O2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CN(C)C(=NCc1ccc([N+](=O)[O-])cc1)N(C)C.I |
| InChI | InChI=1S/C12H18N4O2.HI/c1-14(2)12(15(3)4)13-9-10-5-7-11(8-6-10)16(17)18;/h5-8H,9H2,1-4H3;1H |
| InChIKey | QPSGWLSTIGGNOQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|