C16H14ClN3O2S — CID 11142568
2-(4-chlorophenyl)-N,N-dimethyl-2-(4-nitrophenyl)iminoethanethioamide (PubChem CID 11142568) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-dimethyl-2-(4-nitrophenyl)iminoethanethioamide.
| Compound Name | 2-(4-chlorophenyl)-N,N-dimethyl-2-(4-nitrophenyl)iminoethanethioamide |
|---|---|
| PubChem CID | 11142568 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-dimethyl-2-(4-nitrophenyl)iminoethanethioamide |
| SMILES | CN(C)C(=S)/C(=N\c1ccc([N+](=O)[O-])cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O2S/c1-19(2)16(23)15(11-3-5-12(17)6-4-11)18-13-7-9-14(10-8-13)20(21)22/h3-10H,1-2H3/b18-15- |
| InChIKey | YSSRFIPKEZMHCO-SDXDJHTJSA-N |
| XLogP | 4.26 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|