About 1-chloro-4-nitrobenzene;ethane
1-chloro-4-nitrobenzene;ethane (PubChem CID 90737802) has the molecular formula C8H10ClNO2
and a molecular weight of 187.63 g/mol. Its IUPAC name is 1-chloro-4-nitrobenzene;ethane.
Molecular Properties
| Compound Name | 1-chloro-4-nitrobenzene;ethane |
| PubChem CID | 90737802 |
| Molecular Formula | C8H10ClNO2 |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 1-chloro-4-nitrobenzene;ethane |
| SMILES | CC.O=[N+]([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H4ClNO2.C2H6/c7-5-1-3-6(4-2-5)8(9)10;1-2/h1-4H;1-2H3 |
| InChIKey | FWFFDCJXKBODCM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-nitrobenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-nitrobenzene;ethane?
The IUPAC name of 1-chloro-4-nitrobenzene;ethane (CID 90737802) is 1-chloro-4-nitrobenzene;ethane.
What is the SMILES notation for 1-chloro-4-nitrobenzene;ethane?
The canonical SMILES for 1-chloro-4-nitrobenzene;ethane is CC.O=[N+]([O-])c1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-nitrobenzene;ethane?
The InChIKey is FWFFDCJXKBODCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO2.C2H6/c7-5-1-3-6(4-2-5)8(9)10;1-2/h1-4H;1-2H3.
What are the key properties of 1-chloro-4-nitrobenzene;ethane?
1-chloro-4-nitrobenzene;ethane has a molecular weight of 187.63 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-nitrobenzene;ethane is sourced from PubChem (CID 90737802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).