C14H10Br2ClNO2 — CID 101113752
1-[(1R,2S)-1,2-dibromo-2-(4-chlorophenyl)ethyl]-4-nitrobenzene (PubChem CID 101113752) has the molecular formula C14H10Br2ClNO2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 1-[(1R,2S)-1,2-dibromo-2-(4-chlorophenyl)ethyl]-4-nitrobenzene.
| Compound Name | 1-[(1R,2S)-1,2-dibromo-2-(4-chlorophenyl)ethyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 101113752 |
| Molecular Formula | C14H10Br2ClNO2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 1-[(1R,2S)-1,2-dibromo-2-(4-chlorophenyl)ethyl]-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc([C@@H](Br)[C@@H](Br)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H10Br2ClNO2/c15-13(9-1-5-11(17)6-2-9)14(16)10-3-7-12(8-4-10)18(19)20/h1-8,13-14H/t13-,14+/m0/s1 |
| InChIKey | KOYDEKDZJKNUAA-UONOGXRCSA-N |
| XLogP | 5.82 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|