C27H22ClN3O6S — CID 4863332
4-chloro-N,N'-bis(4-methoxyphenyl)-N-(4-nitrophenyl)sulfonylbenzenecarboximidamide (PubChem CID 4863332) has the molecular formula C27H22ClN3O6S and a molecular weight of 552.01 g/mol. Its IUPAC name is 4-chloro-N,N'-bis(4-methoxyphenyl)-N-(4-nitrophenyl)sulfonylbenzenecarboximidamide.
| Compound Name | 4-chloro-N,N'-bis(4-methoxyphenyl)-N-(4-nitrophenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 4863332 |
| Molecular Formula | C27H22ClN3O6S |
| Molecular Weight | 552.01 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 4-chloro-N,N'-bis(4-methoxyphenyl)-N-(4-nitrophenyl)sulfonylbenzenecarboximidamide |
| SMILES | COc1ccc(/N=C(\c2ccc(Cl)cc2)N(c2ccc(OC)cc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H22ClN3O6S/c1-36-24-13-7-21(8-14-24)29-27(19-3-5-20(28)6-4-19)30(22-9-15-25(37-2)16-10-22)38(34,35)26-17-11-23(12-18-26)31(32)33/h3-18H,1-2H3/b29-27+ |
| InChIKey | JBCBQLIXYIVESG-ORIPQNMZSA-N |
| XLogP | 6.24 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.01 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|