C31H25N3O4S — CID 4863246
N,N'-bis(4-methylphenyl)-N-(4-nitrophenyl)sulfonylnaphthalene-1-carboximidamide (PubChem CID 4863246) has the molecular formula C31H25N3O4S and a molecular weight of 535.63 g/mol. Its IUPAC name is N,N'-bis(4-methylphenyl)-N-(4-nitrophenyl)sulfonylnaphthalene-1-carboximidamide.
| Compound Name | N,N'-bis(4-methylphenyl)-N-(4-nitrophenyl)sulfonylnaphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 4863246 |
| Molecular Formula | C31H25N3O4S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | N,N'-bis(4-methylphenyl)-N-(4-nitrophenyl)sulfonylnaphthalene-1-carboximidamide |
| SMILES | Cc1ccc(/N=C(\c2cccc3ccccc23)N(c2ccc(C)cc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H25N3O4S/c1-22-10-14-25(15-11-22)32-31(30-9-5-7-24-6-3-4-8-29(24)30)33(26-16-12-23(2)13-17-26)39(37,38)28-20-18-27(19-21-28)34(35)36/h3-21H,1-2H3/b32-31+ |
| InChIKey | DNZULBXTNXLTCU-QNEJGDQOSA-N |
| XLogP | 7.34 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|