C20H15N3O7S — CID 19210790
N-(benzenesulfonyl)-N-(4-methylphenyl)-3,5-dinitrobenzamide (PubChem CID 19210790) has the molecular formula C20H15N3O7S and a molecular weight of 441.42 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(4-methylphenyl)-3,5-dinitrobenzamide.
| Compound Name | N-(benzenesulfonyl)-N-(4-methylphenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 19210790 |
| Molecular Formula | C20H15N3O7S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-(benzenesulfonyl)-N-(4-methylphenyl)-3,5-dinitrobenzamide |
| SMILES | Cc1ccc(N(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N3O7S/c1-14-7-9-16(10-8-14)21(31(29,30)19-5-3-2-4-6-19)20(24)15-11-17(22(25)26)13-18(12-15)23(27)28/h2-13H,1H3 |
| InChIKey | ORSUOVJANNMLTR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|