C24H25NO3S — CID 19210617
N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide (PubChem CID 19210617) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide.
| Compound Name | N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19210617 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(4-butylphenyl)-N-(4-methylphenyl)sulfonylbenzamide |
| SMILES | CCCCc1ccc(N(C(=O)c2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25NO3S/c1-3-4-8-20-13-15-22(16-14-20)25(24(26)21-9-6-5-7-10-21)29(27,28)23-17-11-19(2)12-18-23/h5-7,9-18H,3-4,8H2,1-2H3 |
| InChIKey | GPIUXUWNCQACCX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |