C24H24ClNO3S — CID 19210695
N-(4-butylphenyl)-2-chloro-N-(4-methylphenyl)sulfonylbenzamide (PubChem CID 19210695) has the molecular formula C24H24ClNO3S and a molecular weight of 441.98 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-chloro-N-(4-methylphenyl)sulfonylbenzamide.
| Compound Name | N-(4-butylphenyl)-2-chloro-N-(4-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19210695 |
| Molecular Formula | C24H24ClNO3S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-(4-butylphenyl)-2-chloro-N-(4-methylphenyl)sulfonylbenzamide |
| SMILES | CCCCc1ccc(N(C(=O)c2ccccc2Cl)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24ClNO3S/c1-3-4-7-19-12-14-20(15-13-19)26(24(27)22-8-5-6-9-23(22)25)30(28,29)21-16-10-18(2)11-17-21/h5-6,8-17H,3-4,7H2,1-2H3 |
| InChIKey | YEAOEVNZHNHELL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |