C27H26N2O5S — CID 19219016
N-(4-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylacetamide (PubChem CID 19219016) has the molecular formula C27H26N2O5S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylacetamide.
| Compound Name | N-(4-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 19219016 |
| Molecular Formula | C27H26N2O5S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-(4-butylphenyl)-2-(1,3-dioxoisoindol-2-yl)-N-(4-methylphenyl)sulfonylacetamide |
| SMILES | CCCCc1ccc(N(C(=O)CN2C(=O)c3ccccc3C2=O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O5S/c1-3-4-7-20-12-14-21(15-13-20)29(35(33,34)22-16-10-19(2)11-17-22)25(30)18-28-26(31)23-8-5-6-9-24(23)27(28)32/h5-6,8-17H,3-4,7,18H2,1-2H3 |
| InChIKey | FGFADXHKLVSVNN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|