C27H25ClN2O5S — CID 19219040
N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonyl-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19219040) has the molecular formula C27H25ClN2O5S and a molecular weight of 525.03 g/mol. Its IUPAC name is N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonyl-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonyl-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19219040 |
| Molecular Formula | C27H25ClN2O5S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | N-(4-butylphenyl)-N-(4-chlorophenyl)sulfonyl-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CCCCc1ccc(N(C(=O)CCN2C(=O)c3ccccc3C2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H25ClN2O5S/c1-2-3-6-19-9-13-21(14-10-19)30(36(34,35)22-15-11-20(28)12-16-22)25(31)17-18-29-26(32)23-7-4-5-8-24(23)27(29)33/h4-5,7-16H,2-3,6,17-18H2,1H3 |
| InChIKey | GEFBLCKISMPYPQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|