C27H25ClN2O6S — CID 19219104
N-(4-chlorophenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)hexanamide (PubChem CID 19219104) has the molecular formula C27H25ClN2O6S and a molecular weight of 541.03 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)hexanamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 19219104 |
| Molecular Formula | C27H25ClN2O6S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxyphenyl)hexanamide |
| SMILES | COc1ccc(N(C(=O)CCCCCN2C(=O)c3ccccc3C2=O)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H25ClN2O6S/c1-36-21-14-12-20(13-15-21)30(37(34,35)22-16-10-19(28)11-17-22)25(31)9-3-2-6-18-29-26(32)23-7-4-5-8-24(23)27(29)33/h4-5,7-8,10-17H,2-3,6,9,18H2,1H3 |
| InChIKey | AYFKXLAMCPZLHF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|