C26H23ClN2O4 — CID 2582016
N-(4-chlorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-methoxybenzamide (PubChem CID 2582016) has the molecular formula C26H23ClN2O4 and a molecular weight of 462.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-methoxybenzamide.
| Compound Name | N-(4-chlorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 2582016 |
| Molecular Formula | C26H23ClN2O4 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-(4-chlorophenyl)-N-[4-(1,3-dioxoisoindol-2-yl)butyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(CCCCN2C(=O)c3ccccc3C2=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C26H23ClN2O4/c1-33-21-8-6-7-18(17-21)24(30)28(20-13-11-19(27)12-14-20)15-4-5-16-29-25(31)22-9-2-3-10-23(22)26(29)32/h2-3,6-14,17H,4-5,15-16H2,1H3 |
| InChIKey | OSSUSVJVDYEMAH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|