C27H26N2O4 — CID 4013315
N-[4-(1,3-dioxoisoindol-2-yl)butyl]-4-methoxy-N-(4-methylphenyl)benzamide (PubChem CID 4013315) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[4-(1,3-dioxoisoindol-2-yl)butyl]-4-methoxy-N-(4-methylphenyl)benzamide.
| Compound Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-4-methoxy-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 4013315 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[4-(1,3-dioxoisoindol-2-yl)butyl]-4-methoxy-N-(4-methylphenyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CCCCN2C(=O)c3ccccc3C2=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O4/c1-19-9-13-21(14-10-19)28(25(30)20-11-15-22(33-2)16-12-20)17-5-6-18-29-26(31)23-7-3-4-8-24(23)27(29)32/h3-4,7-16H,5-6,17-18H2,1-2H3 |
| InChIKey | KZEFQQLNCFDQIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|