C28H28N2O3 — CID 3981151
4-tert-butyl-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-methylphenyl)benzamide (PubChem CID 3981151) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-methylphenyl)benzamide.
| Compound Name | 4-tert-butyl-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 3981151 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-tert-butyl-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(N(CCN2C(=O)c3ccccc3C2=O)C(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O3/c1-19-9-15-22(16-10-19)29(25(31)20-11-13-21(14-12-20)28(2,3)4)17-18-30-26(32)23-7-5-6-8-24(23)27(30)33/h5-16H,17-18H2,1-4H3 |
| InChIKey | YOJARAMEXWHVSM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|