C19H18N2O3 — CID 102234851
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide (PubChem CID 102234851) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 102234851 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide |
| SMILES | CCN(CCN1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O3/c1-2-20(17(22)14-8-4-3-5-9-14)12-13-21-18(23)15-10-6-7-11-16(15)19(21)24/h3-11H,2,12-13H2,1H3 |
| InChIKey | VUXHXXFQHWDUII-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|