C22H22N2O3 — CID 60519917
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)benzamide (PubChem CID 60519917) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 60519917 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CN(CC)C(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H22N2O3/c1-4-23(13-15(2)3)20(25)17-9-7-8-16(12-17)14-24-21(26)18-10-5-6-11-19(18)22(24)27/h5-12H,2,4,13-14H2,1,3H3 |
| InChIKey | UODIUDZOGIXQNV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|