C20H22ClN3O3 — CID 120829754
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(methylamino)propyl]benzamide;hydrochloride (PubChem CID 120829754) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(methylamino)propyl]benzamide;hydrochloride.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(methylamino)propyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120829754 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-(methylamino)propyl]benzamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1.Cl |
| InChI | InChI=1S/C20H21N3O3.ClH/c1-13(21-2)11-22-18(24)15-7-5-6-14(10-15)12-23-19(25)16-8-3-4-9-17(16)20(23)26;/h3-10,13,21H,11-12H2,1-2H3,(H,22,24);1H |
| InChIKey | MTNBZARGEZDKPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|