C24H18F2N2O3 — CID 112763749
N-[1-(2,4-difluorophenyl)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide (PubChem CID 112763749) has the molecular formula C24H18F2N2O3 and a molecular weight of 420.42 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 112763749 |
| Molecular Formula | C24H18F2N2O3 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-[(1,3-dioxoisoindol-2-yl)methyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C24H18F2N2O3/c1-14(18-10-9-17(25)12-21(18)26)27-22(29)16-6-4-5-15(11-16)13-28-23(30)19-7-2-3-8-20(19)24(28)31/h2-12,14H,13H2,1H3,(H,27,29) |
| InChIKey | OTPASBGMFQDVTK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|