C26H21FN2O5 — CID 55994649
methyl 3-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-3-(4-fluorophenyl)propanoate (PubChem CID 55994649) has the molecular formula C26H21FN2O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is methyl 3-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-3-(4-fluorophenyl)propanoate.
| Compound Name | methyl 3-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 55994649 |
| Molecular Formula | C26H21FN2O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | methyl 3-[[3-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]-3-(4-fluorophenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN2O5/c1-34-23(30)14-22(17-9-11-19(27)12-10-17)28-24(31)18-6-4-5-16(13-18)15-29-25(32)20-7-2-3-8-21(20)26(29)33/h2-13,22H,14-15H2,1H3,(H,28,31) |
| InChIKey | KRJPXGWRFIUNHT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|