C18H15F4NO3 — CID 52733979
methyl (3S)-3-(4-fluorophenyl)-3-[[4-(trifluoromethyl)benzoyl]amino]propanoate (PubChem CID 52733979) has the molecular formula C18H15F4NO3 and a molecular weight of 369.31 g/mol. Its IUPAC name is methyl (3S)-3-(4-fluorophenyl)-3-[[4-(trifluoromethyl)benzoyl]amino]propanoate.
| Compound Name | methyl (3S)-3-(4-fluorophenyl)-3-[[4-(trifluoromethyl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 52733979 |
| Molecular Formula | C18H15F4NO3 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | methyl (3S)-3-(4-fluorophenyl)-3-[[4-(trifluoromethyl)benzoyl]amino]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15F4NO3/c1-26-16(24)10-15(11-4-8-14(19)9-5-11)23-17(25)12-2-6-13(7-3-12)18(20,21)22/h2-9,15H,10H2,1H3,(H,23,25)/t15-/m0/s1 |
| InChIKey | BTENPUXRFGAWNL-HNNXBMFYSA-N |
| XLogP | 3.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |