C30H24F3NO3 — CID 69400035
methyl 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate (PubChem CID 69400035) has the molecular formula C30H24F3NO3 and a molecular weight of 503.52 g/mol. Its IUPAC name is methyl 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 69400035 |
| Molecular Formula | C30H24F3NO3 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | methyl 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24F3NO3/c1-37-28(35)19-27(24-11-7-21(8-12-24)20-5-3-2-4-6-20)34-29(36)25-13-9-22(10-14-25)23-15-17-26(18-16-23)30(31,32)33/h2-18,27H,19H2,1H3,(H,34,36) |
| InChIKey | WUYGMIDJZGNENN-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |