C30H23F3N2O4 — CID 87913293
3-[(4-phenylbenzoyl)amino]-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid (PubChem CID 87913293) has the molecular formula C30H23F3N2O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is 3-[(4-phenylbenzoyl)amino]-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[(4-phenylbenzoyl)amino]-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87913293 |
| Molecular Formula | C30H23F3N2O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 3-[(4-phenylbenzoyl)amino]-3-[[4-[4-(trifluoromethyl)phenyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(-c2ccccc2)cc1)NC(=O)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H23F3N2O4/c31-30(32,33)25-16-14-22(15-17-25)21-8-12-24(13-9-21)29(39)35-26(18-27(36)37)34-28(38)23-10-6-20(7-11-23)19-4-2-1-3-5-19/h1-17,26H,18H2,(H,34,38)(H,35,39)(H,36,37) |
| InChIKey | JCBUSSZTDCYFIO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|