C20H16F2N2O3 — CID 55821382
N-[3-[1-(2,4-difluorophenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide (PubChem CID 55821382) has the molecular formula C20H16F2N2O3 and a molecular weight of 370.36 g/mol. Its IUPAC name is N-[3-[1-(2,4-difluorophenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-(2,4-difluorophenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55821382 |
| Molecular Formula | C20H16F2N2O3 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[3-[1-(2,4-difluorophenyl)ethylcarbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1cccc(NC(=O)c2ccco2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F2N2O3/c1-12(16-8-7-14(21)11-17(16)22)23-19(25)13-4-2-5-15(10-13)24-20(26)18-6-3-9-27-18/h2-12H,1H3,(H,23,25)(H,24,26) |
| InChIKey | VDWPGEIQYSKJKO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |