C26H21N5O3 — CID 60592964
3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 60592964) has the molecular formula C26H21N5O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 60592964 |
| Molecular Formula | C26H21N5O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(CN2C(=O)c3ccccc3C2=O)c1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C26H21N5O3/c1-17(19-9-11-21(12-10-19)31-16-27-15-28-31)29-24(32)20-6-4-5-18(13-20)14-30-25(33)22-7-2-3-8-23(22)26(30)34/h2-13,15-17H,14H2,1H3,(H,29,32) |
| InChIKey | INNSOOVXCLRMCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|