C20H17N5O3 — CID 39964916
2-methyl-1,3-dioxo-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]isoindole-5-carboxamide (PubChem CID 39964916) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]isoindole-5-carboxamide.
| Compound Name | 2-methyl-1,3-dioxo-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 39964916 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]isoindole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)C(=O)N(C)C2=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C20H17N5O3/c1-12(13-3-6-15(7-4-13)25-11-21-10-22-25)23-18(26)14-5-8-16-17(9-14)20(28)24(2)19(16)27/h3-12H,1-2H3,(H,23,26)/t12-/m1/s1 |
| InChIKey | XXLXTDAUVWGPHO-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|