C16H14ClN5O — CID 51197578
6-chloro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyridine-3-carboxamide (PubChem CID 51197578) has the molecular formula C16H14ClN5O and a molecular weight of 327.78 g/mol. Its IUPAC name is 6-chloro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51197578 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-chloro-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1ccc(Cl)nc1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H14ClN5O/c1-11(21-16(23)13-4-7-15(17)19-8-13)12-2-5-14(6-3-12)22-10-18-9-20-22/h2-11H,1H3,(H,21,23) |
| InChIKey | LQQDYOKQDWECPN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|