C18H19N5O3S — CID 51221629
4-(methylsulfamoyl)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide (PubChem CID 51221629) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 4-(methylsulfamoyl)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide.
| Compound Name | 4-(methylsulfamoyl)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 51221629 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-(methylsulfamoyl)-N-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]benzamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)NC(C)c2ccc(-n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C18H19N5O3S/c1-13(14-3-7-16(8-4-14)23-12-20-11-21-23)22-18(24)15-5-9-17(10-6-15)27(25,26)19-2/h3-13,19H,1-2H3,(H,22,24) |
| InChIKey | QLXLWANEIKEMFS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |