About CID 174412487
CID 174412487 (PubChem CID 174412487) has the molecular formula C11H17NOS2
and a molecular weight of 243.40 g/mol.
Molecular Properties
| Compound Name | CID 174412487 |
| PubChem CID | 174412487 |
| Molecular Formula | C11H17NOS2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | — |
| SMILES | CCN(CC)C(=O)c1ccccc1.SS |
| InChI | InChI=1S/C11H15NO.H2S2/c1-3-12(4-2)11(13)10-8-6-5-7-9-10;1-2/h5-9H,3-4H2,1-2H3;1-2H |
| InChIKey | BTXFKDCGXFGDGT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 174412487 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174412487?
The IUPAC name of CID 174412487 (CID 174412487) is not available.
What is the SMILES notation for CID 174412487?
The canonical SMILES for CID 174412487 is CCN(CC)C(=O)c1ccccc1.SS.
What is the InChIKey of CID 174412487?
The InChIKey is BTXFKDCGXFGDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.H2S2/c1-3-12(4-2)11(13)10-8-6-5-7-9-10;1-2/h5-9H,3-4H2,1-2H3;1-2H.
What are the key properties of CID 174412487?
CID 174412487 has a molecular weight of 243.40 g/mol, XLogP of 2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174412487 is sourced from PubChem (CID 174412487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).