C16H27NO — CID 142910544
N-(2,2-dimethylpropyl)-N-ethylbenzamide;ethane (PubChem CID 142910544) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N-ethylbenzamide;ethane.
| Compound Name | N-(2,2-dimethylpropyl)-N-ethylbenzamide;ethane |
|---|---|
| PubChem CID | 142910544 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N-ethylbenzamide;ethane |
| SMILES | CC.CCN(CC(C)(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO.C2H6/c1-5-15(11-14(2,3)4)13(16)12-9-7-6-8-10-12;1-2/h6-10H,5,11H2,1-4H3;1-2H3 |
| InChIKey | OGYQHDPGVVHFPJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |