C11H15B3F12K3NO — CID 121234148
tripotassium;N,N-diethylbenzamide;tritetrafluoroborate (PubChem CID 121234148) has the molecular formula C11H15B3F12K3NO and a molecular weight of 554.95 g/mol. Its IUPAC name is tripotassium;N,N-diethylbenzamide;tritetrafluoroborate.
| Compound Name | tripotassium;N,N-diethylbenzamide;tritetrafluoroborate |
|---|---|
| PubChem CID | 121234148 |
| Molecular Formula | C11H15B3F12K3NO |
| Molecular Weight | 554.95 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | tripotassium;N,N-diethylbenzamide;tritetrafluoroborate |
| SMILES | CCN(CC)C(=O)c1ccccc1.F[B-](F)(F)F.F[B-](F)(F)F.F[B-](F)(F)F.[K+].[K+].[K+] |
| InChI | InChI=1S/C11H15NO.3BF4.3K/c1-3-12(4-2)11(13)10-8-6-5-7-9-10;3*2-1(3,4)5;;;/h5-9H,3-4H2,1-2H3;;;;;;/q;3*-1;3*+1 |
| InChIKey | RVODAOTVMHADPJ-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.95 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|