C14H17N3O3 — CID 19258990
3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-diethylurea (PubChem CID 19258990) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-diethylurea.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 19258990 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H17N3O3/c1-3-16(4-2)14(20)15-9-17-12(18)10-7-5-6-8-11(10)13(17)19/h5-8H,3-4,9H2,1-2H3,(H,15,20) |
| InChIKey | ZPGHYPOEEOBHOP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|