C16H21N3O3 — CID 19258991
3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-dipropylurea (PubChem CID 19258991) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-dipropylurea.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 19258991 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H21N3O3/c1-3-9-18(10-4-2)16(22)17-11-19-14(20)12-7-5-6-8-13(12)15(19)21/h5-8H,3-4,9-11H2,1-2H3,(H,17,22) |
| InChIKey | QALQDLWYLLIXNY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|