About 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea
3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea (PubChem CID 66491139) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea |
| PubChem CID | 66491139 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-3-13-24(14-4-2)22(28)23-15-16-9-11-17(12-10-16)25-20(26)18-7-5-6-8-19(18)21(25)27/h5-12H,3-4,13-15H2,1-2H3,(H,23,28) |
| InChIKey | ZONLXYBQSKTZHU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea?
The IUPAC name of 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea (CID 66491139) is 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea.
What is the SMILES notation for 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea?
The canonical SMILES for 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea is CCCN(CCC)C(=O)NCc1ccc(N2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea?
The InChIKey is ZONLXYBQSKTZHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O3/c1-3-13-24(14-4-2)22(28)23-15-16-9-11-17(12-10-16)25-20(26)18-7-5-6-8-19(18)21(25)27/h5-12H,3-4,13-15H2,1-2H3,(H,23,28).
What are the key properties of 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea?
3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea has a molecular weight of 379.46 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-1,1-dipropylurea is sourced from PubChem (CID 66491139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).