C17H14N2O3 — CID 17234242
4-(1,3-dioxoisoindol-2-yl)-N-ethylbenzamide (PubChem CID 17234242) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-ethylbenzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 17234242 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C17H14N2O3/c1-2-18-15(20)11-7-9-12(10-8-11)19-16(21)13-5-3-4-6-14(13)17(19)22/h3-10H,2H2,1H3,(H,18,20) |
| InChIKey | GPYDXCGEHOJRCV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|