C22H35N3O2 — CID 121306924
3-[[4-[[2-methyl-2-(2-methylpropyl)-3-oxoaziridin-1-yl]methyl]phenyl]methyl]-1,1-dipropylurea (PubChem CID 121306924) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 3-[[4-[[2-methyl-2-(2-methylpropyl)-3-oxoaziridin-1-yl]methyl]phenyl]methyl]-1,1-dipropylurea.
| Compound Name | 3-[[4-[[2-methyl-2-(2-methylpropyl)-3-oxoaziridin-1-yl]methyl]phenyl]methyl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 121306924 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 3-[[4-[[2-methyl-2-(2-methylpropyl)-3-oxoaziridin-1-yl]methyl]phenyl]methyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)NCc1ccc(CN2C(=O)C2(C)CC(C)C)cc1 |
| InChI | InChI=1S/C22H35N3O2/c1-6-12-24(13-7-2)21(27)23-15-18-8-10-19(11-9-18)16-25-20(26)22(25,5)14-17(3)4/h8-11,17H,6-7,12-16H2,1-5H3,(H,23,27) |
| InChIKey | LJMVERLSOWWDHN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 52.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|