C23H19N3O3 — CID 66491140
1-benzyl-3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]urea (PubChem CID 66491140) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]urea.
| Compound Name | 1-benzyl-3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 66491140 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-benzyl-3-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O3/c27-21-19-8-4-5-9-20(19)22(28)26(21)18-12-10-17(11-13-18)15-25-23(29)24-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H2,24,25,29) |
| InChIKey | CTKBPAZQVPZELM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|