C27H25NO4 — CID 56676513
5-[4-[2-[4-(1,3-dioxoisoindol-2-yl)phenyl]ethyl]phenyl]pentanoic acid (PubChem CID 56676513) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 5-[4-[2-[4-(1,3-dioxoisoindol-2-yl)phenyl]ethyl]phenyl]pentanoic acid.
| Compound Name | 5-[4-[2-[4-(1,3-dioxoisoindol-2-yl)phenyl]ethyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 56676513 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 5-[4-[2-[4-(1,3-dioxoisoindol-2-yl)phenyl]ethyl]phenyl]pentanoic acid |
| SMILES | O=C(O)CCCCc1ccc(CCc2ccc(N3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H25NO4/c29-25(30)8-4-1-5-19-9-11-20(12-10-19)13-14-21-15-17-22(18-16-21)28-26(31)23-6-2-3-7-24(23)27(28)32/h2-3,6-7,9-12,15-18H,1,4-5,8,13-14H2,(H,29,30) |
| InChIKey | FOXRLCWJNCUJMS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|