About 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea
1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea (PubChem CID 66491225) has the molecular formula C21H16N4O4
and a molecular weight of 388.38 g/mol. Its IUPAC name is 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea |
| PubChem CID | 66491225 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea |
| SMILES | O=C(NCc1ccc(N2C(=O)c3ccccc3C2=O)cc1)Nc1ncccc1O |
| InChI | InChI=1S/C21H16N4O4/c26-17-6-3-11-22-18(17)24-21(29)23-12-13-7-9-14(10-8-13)25-19(27)15-4-1-2-5-16(15)20(25)28/h1-11,26H,12H2,(H2,22,23,24,29) |
| InChIKey | GLBULQAVJVTYIW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea?
The IUPAC name of 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea (CID 66491225) is 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea.
What is the SMILES notation for 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea?
The canonical SMILES for 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea is O=C(NCc1ccc(N2C(=O)c3ccccc3C2=O)cc1)Nc1ncccc1O.
What is the InChIKey of 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea?
The InChIKey is GLBULQAVJVTYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O4/c26-17-6-3-11-22-18(17)24-21(29)23-12-13-7-9-14(10-8-13)25-19(27)15-4-1-2-5-16(15)20(25)28/h1-11,26H,12H2,(H2,22,23,24,29).
What are the key properties of 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea?
1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea has a molecular weight of 388.38 g/mol, XLogP of 2.91, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl]-3-(3-hydroxy-2-pyridinyl)urea is sourced from PubChem (CID 66491225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).