C13H14N4O4S — CID 19133929
1-(benzenesulfonamidomethyl)-3-(3-hydroxy-2-pyridinyl)urea (PubChem CID 19133929) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-(benzenesulfonamidomethyl)-3-(3-hydroxy-2-pyridinyl)urea.
| Compound Name | 1-(benzenesulfonamidomethyl)-3-(3-hydroxy-2-pyridinyl)urea |
|---|---|
| PubChem CID | 19133929 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-(benzenesulfonamidomethyl)-3-(3-hydroxy-2-pyridinyl)urea |
| SMILES | O=C(NCNS(=O)(=O)c1ccccc1)Nc1ncccc1O |
| InChI | InChI=1S/C13H14N4O4S/c18-11-7-4-8-14-12(11)17-13(19)15-9-16-22(20,21)10-5-2-1-3-6-10/h1-8,16,18H,9H2,(H2,14,15,17,19) |
| InChIKey | XAJDOOKZJGODIS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|