C15H16BrN3O3S — CID 19133960
1-(4-bromophenyl)-3-[[(4-methylphenyl)sulfonylamino]methyl]urea (PubChem CID 19133960) has the molecular formula C15H16BrN3O3S and a molecular weight of 398.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[(4-methylphenyl)sulfonylamino]methyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[[(4-methylphenyl)sulfonylamino]methyl]urea |
|---|---|
| PubChem CID | 19133960 |
| Molecular Formula | C15H16BrN3O3S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[(4-methylphenyl)sulfonylamino]methyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NCNC(=O)Nc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C15H16BrN3O3S/c1-11-2-8-14(9-3-11)23(21,22)18-10-17-15(20)19-13-6-4-12(16)5-7-13/h2-9,18H,10H2,1H3,(H2,17,19,20) |
| InChIKey | MJNIKSIWLNRNQP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|