C27H32N8O8S — CID 136777572
1-[2-[2-[(4-methylphenyl)sulfonylamino]ethyl-[2-[(4-nitrophenyl)carbamoylamino]ethyl]amino]ethyl]-3-(4-nitrophenyl)urea (PubChem CID 136777572) has the molecular formula C27H32N8O8S and a molecular weight of 628.67 g/mol. Its IUPAC name is 1-[2-[2-[(4-methylphenyl)sulfonylamino]ethyl-[2-[(4-nitrophenyl)carbamoylamino]ethyl]amino]ethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-[2-[(4-methylphenyl)sulfonylamino]ethyl-[2-[(4-nitrophenyl)carbamoylamino]ethyl]amino]ethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 136777572 |
| Molecular Formula | C27H32N8O8S |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 1-[2-[2-[(4-methylphenyl)sulfonylamino]ethyl-[2-[(4-nitrophenyl)carbamoylamino]ethyl]amino]ethyl]-3-(4-nitrophenyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NCCN(CCNC(=O)Nc2ccc([N+](=O)[O-])cc2)CCNC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H32N8O8S/c1-20-2-12-25(13-3-20)44(42,43)30-16-19-33(17-14-28-26(36)31-21-4-8-23(9-5-21)34(38)39)18-15-29-27(37)32-22-6-10-24(11-7-22)35(40)41/h2-13,30H,14-19H2,1H3,(H2,28,31,36)(H2,29,32,37) |
| InChIKey | DCJSETLWFXKZNC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 217.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|