C14H13N3O5S — CID 4604602
1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)urea (PubChem CID 4604602) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 4604602 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H13N3O5S/c1-10-2-8-13(9-3-10)23(21,22)16-14(18)15-11-4-6-12(7-5-11)17(19)20/h2-9H,1H3,(H2,15,16,18) |
| InChIKey | OYXKERRSGYRTKU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|