C18H18N4O3S2 — CID 19133974
1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 19133974) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 19133974 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1-[[(4-methylphenyl)sulfonylamino]methyl]-3-(4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NCNC(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C18H18N4O3S2/c1-13-7-9-15(10-8-13)27(24,25)20-12-19-17(23)22-18-21-16(11-26-18)14-5-3-2-4-6-14/h2-11,20H,12H2,1H3,(H2,19,21,22,23) |
| InChIKey | SCCNLQUDTQMWPZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|