C21H23N5O3 — CID 145106429
2-amino-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide;ethane-1,2-diimine (PubChem CID 145106429) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-amino-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide;ethane-1,2-diimine.
| Compound Name | 2-amino-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide;ethane-1,2-diimine |
|---|---|
| PubChem CID | 145106429 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-amino-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-ethylbenzamide;ethane-1,2-diimine |
| SMILES | CCN(CCN1C(=O)c2ccccc2C1=O)C(=O)c1ccccc1N.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C19H19N3O3.C2H4N2/c1-2-21(17(23)15-9-5-6-10-16(15)20)11-12-22-18(24)13-7-3-4-8-14(13)19(22)25;3-1-2-4/h3-10H,2,11-12,20H2,1H3;1-4H/b;3-1+,4-2+ |
| InChIKey | JXQYCPKTUOHJCF-BZGZIVBQSA-N |
| XLogP | 2.31 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|