C11H10N2O2 — CID 90696348
2-(3-iminopropyl)isoindole-1,3-dione (PubChem CID 90696348) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(3-iminopropyl)isoindole-1,3-dione.
| Compound Name | 2-(3-iminopropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 90696348 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(3-iminopropyl)isoindole-1,3-dione |
| SMILES | [H]/N=C/CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H10N2O2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-6,12H,3,7H2/b12-6+ |
| InChIKey | FAUPYLPIXIPHQF-WUXMJOGZSA-N |
| XLogP | 1.32 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|