C28H29N3O5S — CID 3914689
4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-methylphenyl)benzamide (PubChem CID 3914689) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-methylphenyl)benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 3914689 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(3-methylphenyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N(CCN2C(=O)c3ccccc3C2=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C28H29N3O5S/c1-4-29(5-2)37(35,36)23-15-13-21(14-16-23)26(32)30(22-10-8-9-20(3)19-22)17-18-31-27(33)24-11-6-7-12-25(24)28(31)34/h6-16,19H,4-5,17-18H2,1-3H3 |
| InChIKey | RMMQFWMCRPPTAU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|