C29H31N3O6S — CID 3383532
4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-ethoxyphenyl)benzamide (PubChem CID 3383532) has the molecular formula C29H31N3O6S and a molecular weight of 549.65 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3383532 |
| Molecular Formula | C29H31N3O6S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(N(CCN2C(=O)c3ccccc3C2=O)C(=O)c2ccc(S(=O)(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C29H31N3O6S/c1-4-30(5-2)39(36,37)24-17-11-21(12-18-24)27(33)31(22-13-15-23(16-14-22)38-6-3)19-20-32-28(34)25-9-7-8-10-26(25)29(32)35/h7-18H,4-6,19-20H2,1-3H3 |
| InChIKey | KKABPTCAZMWZRN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|