C24H19BrN2O4 — CID 2326703
2-bromo-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-ethoxyphenyl)benzamide (PubChem CID 2326703) has the molecular formula C24H19BrN2O4 and a molecular weight of 479.33 g/mol. Its IUPAC name is 2-bromo-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 2-bromo-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2326703 |
| Molecular Formula | C24H19BrN2O4 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2-bromo-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(N(CN2C(=O)c3ccccc3C2=O)C(=O)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C24H19BrN2O4/c1-2-31-17-13-11-16(12-14-17)26(24(30)20-9-5-6-10-21(20)25)15-27-22(28)18-7-3-4-8-19(18)23(27)29/h3-14H,2,15H2,1H3 |
| InChIKey | MGAHNJBEKRVEIB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|