C25H20N4O8 — CID 3377075
N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(2-ethoxyphenyl)-3,5-dinitrobenzamide (PubChem CID 3377075) has the molecular formula C25H20N4O8 and a molecular weight of 504.46 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(2-ethoxyphenyl)-3,5-dinitrobenzamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(2-ethoxyphenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3377075 |
| Molecular Formula | C25H20N4O8 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethyl]-N-(2-ethoxyphenyl)-3,5-dinitrobenzamide |
| SMILES | CCOc1ccccc1N(CCN1C(=O)c2ccccc2C1=O)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20N4O8/c1-2-37-22-10-6-5-9-21(22)26(11-12-27-24(31)19-7-3-4-8-20(19)25(27)32)23(30)16-13-17(28(33)34)15-18(14-16)29(35)36/h3-10,13-15H,2,11-12H2,1H3 |
| InChIKey | WQGWAZQIWRPHMG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|